dc.contributor.author | Güneş, Bilal | |
dc.contributor.author | Soylu, Hüseyin | |
dc.contributor.author | Akkurt, Mehmet | |
dc.contributor.author | Özbey, Süheyla | |
dc.date.accessioned | 2019-12-13T06:25:24Z | |
dc.date.available | 2019-12-13T06:25:24Z | |
dc.date.issued | 1995 | |
dc.identifier.issn | 0108-2701 | |
dc.identifier.uri | https://doi.org/10.1107/S0108270195006202 | |
dc.identifier.uri | http://hdl.handle.net/11655/18108 | |
dc.description.abstract | The structure of aminoethylammonium tartrate, C2H9N2+.C4H5O6-, is ionic. Ethylenediamine forms a very stable salt with tartaric acid, similar to C2H10N22+.2HPO(4)(2-).6H(2)O [Averbuch-Pouchot, Durif & Guitel (1987). Acta Cryst. C43, 1896-1898] and C2H10N22+.2C(4)H(5)O(6)(-).2H(2)O [Perez, (1977). Acta Cryst. B33, 1083-1087]. The protonated ethylenediamine monocations are linked to the tartrate anions by strong N-H ... O hydrogen bonds [N ... O 2.921(4), H ... O 2.083(4) Angstrom, N-H ... O 156.8(3)degrees]. The bond lengths and angles are comparable with corresponding values observed in related molecules. | |
dc.language.iso | en | |
dc.publisher | Munksgaard Int Publ Ltd | |
dc.relation.isversionof | 10.1107/S0108270195006202 | |
dc.rights | info:eu-repo/semantics/openAccess | |
dc.subject | Chemistry | |
dc.subject | Crystallography | |
dc.title | Aminoethylammonium Tartrate | |
dc.type | info:eu-repo/semantics/article | |
dc.type | info:eu-repo/semantics/publishedVersion | |
dc.relation.journal | Acta Crystallographica Section C-Crystal Structure Communications | |
dc.contributor.department | Fizik Mühendisliği | |
dc.identifier.volume | 51 | |
dc.identifier.startpage | 2346 | |
dc.identifier.endpage | 2348 | |
dc.description.index | WoS | |